![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Pagerank Explained C..> | 2015-05-22 15:39 | - | |
| markov chains/ | 2015-05-22 15:39 | - | |
| www9 paper_files/ | 2015-05-22 15:39 | - | |
| hypersearching_web.html | 2015-05-22 15:39 | 26K | |
| The Structure of Inf..> | 2015-05-22 15:39 | 41K | |
| www9 paper.html | 2015-05-22 15:39 | 56K | |
| minhash.ppt | 2015-05-22 15:39 | 56K | |
| intelligent_surfer_i..> | 2015-05-22 15:39 | 59K | |
| Pagerank Explained C..> | 2015-05-22 15:39 | 73K | |
| page-rank.doc | 2015-05-22 15:39 | 98K | |
| KLINBERG_authoritati..> | 2015-05-22 15:39 | 256K | |
| haveliwala02topicsen..> | 2015-05-22 15:39 | 260K | |
| powerlaw_internet_to..> | 2015-05-22 15:39 | 451K | |